Interesting facts
Interesting Facts about 1-(2-Methoxyphenyl)propan-1-ol
1-(2-Methoxyphenyl)propan-1-ol is an intriguing organic compound with various applications and interesting aspects worth exploring. Here are some fascinating points:
- Functional Versatility: This compound is an alcohol with a methoxy group, highlighting its potential to participate in numerous chemical reactions, including nucleophilic substitutions and oxidation processes.
- Flavour and Fragrance: The methoxy group in the compound lends it a distinctive aroma, making it useful in the formulation of flavorings and perfumes. Methoxy-substituted compounds are often components of complex fragrances.
- Biological Activity: Compounds similar to 1-(2-methoxyphenyl)propan-1-ol have been studied for their potential antimicrobial properties. Researchers are continually exploring such molecules to find new therapeutic agents.
- Synthetic Pathways: This compound can be synthesized through several methods, including the use of starting materials that are readily available in most organic chemistry laboratories. It exemplifies the beauty of organic synthesis and the creativity required in the field.
- Chiral Importance: As an alcohol, it may possess chiral characteristics. The study of its stereochemistry can lead to the discovery of enantiomers with significantly different biological activities.
In summary, 1-(2-methoxyphenyl)propan-1-ol stands as an excellent example of how simple organic compounds can have multifaceted roles in various fields, from industrial applications to extensive medicinal research. Exploring its properties and potential uses contributes significantly to the vast knowledge of organic chemistry.
Synonyms
Benzenemethanol, alpha-ethyl-2-methoxy-
Benzenemethanol, .alpha.-ethyl-2-methoxy-
1-(2-Methoxyphenyl)-1-propanol
7452-01-9
1-(2-methoxyphenyl)propan-1-ol
(R)-1-(2-Methoxyphenyl)propanol
(S)-1-(2-Methoxyphenyl)propanol
alpha-Ethyl-o-methoxybenzyl alcohol
1-(2-Methoxyphenyl)propanol
SCHEMBL3929054
DTXSID10996041
EINECS 231-221-2
1-(2-Methoxyphenyl)-1-propanol #
MFCD03427118
.alpha.-Ethyl-o-methoxybenzyl alcohol
1-(2-Methoxyphenyl)-1-propanol 97
AKOS009536643
AI3-19308
ALPHA-ETHYL-2-METHOXYBENZENEMETHANOL
NS00048007
N14415
InChI=1/C10H14O2/c1-3-9(11)8-6-4-5-7-10(8)12-2/h4-7,9,11H,3H2,1-2H
Solubility of 1-(2-methoxyphenyl)propan-1-ol
1-(2-methoxyphenyl)propan-1-ol, known for its distinct molecular structure, exhibits interesting solubility characteristics influenced by its functional groups. Here’s a closer look at its solubility properties:
In summary, while 1-(2-methoxyphenyl)propan-1-ol shows a preference for solubility in organic solvents, its water solubility may present challenges. As we explore more about such compounds, it is crucial to consider their functional groups and molecular structure, which play a pivotal role in determining solubility.