Interesting facts
Interesting Facts about 1-Ethyl-2-methylene-aziridine
1-Ethyl-2-methylene-aziridine is an intriguing compound that belongs to the class of aziridines, which are three-membered cyclic amines. This compound is notable for several reasons:
- Structure and Reactivity: The unique structure of aziridines allows for a high degree of ring strain, which contributes to their reactivity. This can lead to interesting chemical behaviors, such as undergoing nucleophilic ring-opening reactions.
- Potential Applications: Aziridines, including 1-ethyl-2-methylene-aziridine, are explored for their applications in the synthesis of biologically active compounds and pharmaceuticals. Their reactivity makes them valuable intermediates in organic chemistry.
- Polymer Chemistry: This compound is also of interest in polymer chemistry, where it may serve as a building block for creating novel copolymers with desirable properties. It showcases how small structural changes can lead to substantial variations in material characteristics.
- Research Interest: Over the years, 1-ethyl-2-methylene-aziridine has become a focus of research due to its potential effects in the synthesis of fine chemicals. Scholars are particularly intrigued by its role in advancing the development of new medicinal compounds.
In conclusion, 1-ethyl-2-methylene-aziridine exemplifies the fascinating interplay between structure and reactivity in organic compounds. As scientists delve deeper into its properties, they continue to uncover potential innovations that this compound may bring to the fields of synthetic chemistry and materials science.
Synonyms
1-Ethyl-2-methyleneaziridine
872-39-9
AZIRIDINE, 1-ETHYL-2-METHYLENE-
NSC-53434
NSC 53434
BRN 0104533
1-ethyl-2-methylen-aziridine
1-ethyl-2-methylideneaziridine
AI3-50490
NSC53434
4-20-00-01905 (Beilstein Handbook Reference)
3559DFB8B8
DTXSID101007399
AZIRIDINE,1-ETHYL,2-METHYLENE
InChI=1/C5H9N/c1-3-6-4-5(6)2/h2-4H2,1H
Solubility of 1-ethyl-2-methylene-aziridine
1-ethyl-2-methylene-aziridine is a unique chemical compound that exhibits intriguing solubility characteristics. Understanding its solubility can provide valuable insights into its reactivity and potential applications. Here are some key points regarding its solubility:
In summary, the solubility of 1-ethyl-2-methylene-aziridine is influenced by several factors including polarity and solvent choice. This makes it essential to consider environmental conditions when working with this compound for effective use in chemical processes.