Interesting facts
Interesting Facts about 1-Methoxy-4-nitroso-benzene
1-Methoxy-4-nitroso-benzene, a fascinating compound in the field of organic chemistry, has garnered attention due to its unique structural features and potential applications. Here are some engaging insights about this compound:
- Structure and Reactivity: The presence of both a methoxy group and a nitroso group on the benzene ring significantly influences its chemical reactivity. The methoxy group is an electron-donating substituent, while the nitroso group introduces reactivity under certain conditions, making it an excellent candidate for further chemical transformations.
- Applications in Synthesis: This compound serves as a valuable intermediate in organic synthesis. Its nitroso group can participate in various reactions, such as the formation of azo compounds or derivatives, highlighting its importance in the production of colored dyes and pharmaceuticals.
- Biological Activities: Research into 1-methoxy-4-nitroso-benzene has suggested potential biological activities. Compounds with similar structures have been studied for their antimicrobial and anticancer properties, paving the way for further exploration of this specific derivative.
- Analytical Chemistry: The unique functional groups of this compound also allow for intriguing applications in analytical chemistry. It can be utilized as a reagent to detect other chemical species or as part of a methodology for quantitative analysis.
- Environmental Concerns: Like many nitroso compounds, there are associated environmental concerns due to potential toxicity. Understanding its behavior and degradation pathways in the environment is essential for ensuring safe handling and minimizing ecological impact.
In summary, 1-methoxy-4-nitroso-benzene stands out as a versatile compound with diverse potential applications in fields ranging from synthetic organic chemistry to medicinal research. Its intriguing properties merit further investigation and highlight the complexity and beauty of organic compounds.
Synonyms
4-Nitrosoanisole
1-Methoxy-4-nitrosobenzene
ANISOLE, p-NITROSO-
1516-21-8
p-Nitrosoanisole
Benzene, 1-methoxy-4-nitroso-
p-Methoxynitrosobenzene
C7H7NO2
4-Methoxynitrosobenzene
CCRIS 2149
BRN 2040562
1-methoxy-4-nitroso-benzene
4-06-00-01245 (Beilstein Handbook Reference)
SCHEMBL156005
DTXSID50164808
AKOS006276198
InChI=1/C7H7NO2/c1-10-7-4-2-6(8-9)3-5-7/h2-5H,1H
Solubility of 1-Methoxy-4-nitroso-benzene
1-Methoxy-4-nitroso-benzene, with its intriguing structure, exhibits certain solubility characteristics that are worth noting. In general, the solubility of this compound can be affected by several factors including:
In summary, the solubility of 1-methoxy-4-nitroso-benzene is influenced by its polarity, the chosen solvent, and temperature. It is vital to take these factors into consideration when working with this compound, as they can significantly affect its behavior in a solution. To quote an old chemist, “In solubility, one must consider the dance of the molecules—solvents and solutes alike.”