Interesting facts
Interesting Facts about (1R,2R)-2-methylcyclopentanol
(1R,2R)-2-methylcyclopentanol is a fascinating compound with several noteworthy aspects:
- Stereochemistry: The designation (1R,2R) indicates the specific 3D arrangement of atoms in the molecule, which is crucial in understanding its chemical behavior. Stereochemistry plays a significant role in the characteristics of enantiomers and diastereomers, affecting how this compound interacts with biological systems.
- Applications: This compound serves as an important intermediate in organic synthesis. It can be utilized in the production of pharmaceuticals and fine chemicals, demonstrating its significance in the field of medicinal chemistry.
- Solvation Shell: The cyclic structure of cyclopentanol affects its solvation properties, making it intriguing for studies related to solvent effects on reactivity. Its methyl group increases steric bulk, influencing interactions with other molecules.
- Natural Sources: Compounds of this type can be found in various natural products, showcasing the intricate relationship between chemistry and nature. The presence of cyclopentanol derivatives in essential oils adds to their importance in the aroma and flavor industries.
- Research Interest: The study of alcohol compounds like (1R,2R)-2-methylcyclopentanol encourages ongoing research in the field of organic chemistry, especially regarding the design of new catalysts and reaction pathways.
As the quote goes, "Chemistry is the essence of life," and compounds like (1R,2R)-2-methylcyclopentanol enrich our understanding of both the microscopic and macroscopic worlds we live in.
In summary, (1R,2R)-2-methylcyclopentanol not only highlights the importance of stereochemistry in chemical compounds but also acts as a bridge between organic chemistry and its practical applications in industry.
Synonyms
trans-2-Methylcyclopentan-1-ol
(1R,2R)-2-methylcyclopentan-1-ol
Cyclopentanol, 2-methyl-, (1R,2R)-rel-
(1R,2R)-2-methylcyclopentanol
EINECS 246-652-1
Trans-2-Methylcylopentanol
trans-2-methyl-cyclopentanol
SCHEMBL622091
DTXSID00179821
trans-2-Methylcyclopentanol, 97%
cyclopentanol, 2-methyl-, (1R,2R)-
rac-(1R,2R)-2-methylcyclopentan-1-ol
DB-257136
NS00027815
EN300-1635090
InChI=1/C6H12O/c1-5-3-2-4-6(5)7/h5-7H,2-4H2,1H3/t5-,6-/m1/s
Solubility of (1R,2R)-2-methylcyclopentanol
(1R,2R)-2-methylcyclopentanol is an organic compound characterized by its unique cyclopentane ring structure with a hydroxyl group (-OH) attached. In terms of solubility, this compound displays interesting characteristics:
As a rule of thumb in organic chemistry, "Like dissolves like." This means that the polar nature of (1R,2R)-2-methylcyclopentanol makes it more compatible with other polar substances compared to non-polar ones. Therefore, understanding its solubility can provide insights into its behavior in different chemical environments.
In conclusion, (1R,2R)-2-methylcyclopentanol exhibits favorable solubility in polar solvents, but its effectiveness as a solvent in non-polar environments may require further exploration.