Interesting facts
Interesting Facts About 2-Amino-9-[3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3H-purin-6-one
This intriguing compound belongs to a class of molecules known as purines, which are fundamental components of nucleotides—the building blocks of DNA and RNA. Here's what makes this compound noteworthy:
- Biological Significance: Due to its purine structure, this compound has potential implications in biological processes. It could play a role in cellular signaling or act as a precursor for important biological molecules.
- Hydroxymethyl Tetrahydrofuran: The presence of the 3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran moiety can significantly influence the compound's chemical behavior and its interactions with other biological molecules. These hydroxyl groups contribute to hydrogen bonding, which is crucial in biochemical interactions.
- Synthetic Routes: The synthesis of such complex compounds is a fascinating area of organic chemistry. Chemists often utilize carefully designed synthetic pathways to construct these molecules, enabling the incorporation of diverse functional groups that may enhance solubility and activity.
- Research Potential: Ongoing research may explore its potential therapeutic applications, especially in fields like pharmacology and biochemistry. Compounds like this one may inspire the development of novel drugs targeting various diseases.
- Quote from Nobel Laureate: As the renowned chemist Linus Pauling once said, “The best way to have a good idea is to have lots of ideas.” Studying such compounds can lead to unexpected results and innovations in chemical research!
Overall, 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3H-purin-6-one exemplifies the intricate link between molecular structure and biological function, making it a fascinating topic of study for both chemical scientists and students alike.
Synonyms
InChI=1/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19
Solubility of 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3H-purin-6-one
The solubility of the compound 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3H-purin-6-one (C10H13N5O5) is an essential consideration for its applications and interactions in various environments.
Factors Influencing Solubility
Several factors affect the solubility of this compound:
General Observations
For practical applications, the solubility of 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3H-purin-6-one can be summarized as follows:
In conclusion, understanding the solubility of this compound is crucial for its effective use in biochemical and pharmaceutical applications. Further experimental data would provide a more definitive profile of its solubility characteristics.