Skip to main content

o-Tolylselenic Acid

ADVERTISEMENT
Identification
Molecular formula
C8H8O2Se
CAS number
694-83-7
IUPAC name
2-methylselanylbenzoic acid
State
State
2-Methylselanylbenzoic acid is a solid at room temperature.
Melting point (Celsius)
131.00
Melting point (Kelvin)
404.15
Boiling point (Celsius)
287.00
Boiling point (Kelvin)
560.15
General information
Molecular weight
201.11g/mol
Molar mass
201.1120g/mol
Density
1.5234g/cm3
Appearence

2-Methylselanylbenzoic acid is a white to off-white crystalline solid with a distinct odor. It can also appear as a powder.

Comment on solubility

Solubility of 2-Methylselanylbenzoic Acid

2-Methylselanylbenzoic acid, with a chemical structure that includes both a benzene ring and a selenium-containing substituent, showcases unique solubility characteristics influenced by its functional groups. Its solubility can be affected by several factors:

  • Polarity: The carboxylic acid group (-COOH) introduces a polar character, which generally enhances solubility in polar solvents like water.
  • Hydrophobic Region: The presence of the methylselanyl group can impart some hydrophobic features, potentially limiting solubility in aqueous environments.
  • pH Influence: The acidity of the benzoic acid moiety can vary with pH; in an acidic environment, the compound may remain largely undissociated, whereas in a basic solution, it may ionize, improving solubility.

Overall, the solubility of 2-methylselanylbenzoic acid is expected to be moderate in polar solvents and significantly influenced by the solvent’s properties. As a general rule:

  1. If dissolved in water, expect limited solubility, particularly at lower pH levels.
  2. In non-polar organic solvents, the solubility may increase due to the hydrophobic characteristics imparted by the selenium substituent.
  3. In the presence of strong bases, solubility may markedly improve as it ionizes.

Thus, understanding the solubility profile of this compound is critical for its applications in various chemical and biological contexts.

Interesting facts

Interesting Facts about 2-Methylselanylbenzoic Acid

2-Methylselanylbenzoic acid is a fascinating compound that captures the attention of chemists due to its unique structure and the intriguing properties associated with selenium-containing compounds. Here are some notable points:

  • Functional Diversity: This compound incorporates both a carboxylic acid and a methylselanyl group, making it an excellent candidate for studies in functionalization and coordination chemistry.
  • Biological Significance: Selenium is known for its role in human health as an essential micronutrient, and compounds like 2-methylselanylbenzoic acid may exhibit antioxidant properties that can contribute positively to various biological systems.
  • Synthesis and Reactions: The synthesis of this compound typically involves selective selenylation reactions. It provides an opportunity to explore synthetic pathways and optimize conditions for creating organoselenium compounds.
  • Application Potential: Research indicates that selenium derivatives can exhibit antimicrobial and anti-inflammatory activities. 2-methylselanylbenzoic acid could be a precursor for developing new therapeutic agents.
  • In Chalcogen Chemistry: This compound exemplifies the versatility of chalcogen elements in organic chemistry, paving the way for further explorations into functional materials and complex organoselenium chemistry.

As you delve into the world of 2-methylselanylbenzoic acid, remember that this compound is just one example of how the integration of various elements can lead to a rich field of study. "In diversity, there is beauty and strength." - Maya Angelou This holds true in chemistry as well!

Synonyms
o-(Methylseleno)benzoic acid
Methylseleno-2-benzoic acid
6547-08-6
2-(methylselanyl)benzoic acid
Benzoic acid, 2-(methylseleno)-
BENZOIC ACID, o-(METHYLSELENO)-
BRN 2613794
Acide methyl seleno-2-benzoique [French]
2-methylselenobenzoic acid
Acide methyl seleno-2-benzoique
SCHEMBL10971294
DTXSID20215790
3-10-00-00240 (Beilstein Handbook Reference)
InChI=1/C8H8O2Se/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10