Interesting facts
Interesting Facts about 2-Phenylthiochromane
2-Phenylthiochromane is an intriguing compound that belongs to the class of thiochromanes. This compound exhibits a fascinating structure which incorporates both the chromane core and a phenylthio substitution. Here are some key points that highlight its scientific significance:
- Structural Uniqueness: The combination of the chromane structure and thiophenyl group gives this compound unique properties, making it a topic of interest for organic synthesis and medicinal chemistry.
- Potential Applications: Compounds like 2-phenylthiochromane are studied for their potential uses in pharmaceuticals, especially due to their bioactive properties. Certain derivatives have shown promise in areas such as anti-inflammatory and antioxidant activities.
- Synthesis Challenges: The synthesis of 2-phenylthiochromane can be challenging and may involve multi-step processes, requiring chemists to utilize various reaction techniques to achieve desired yields and purities.
- Research Interest: Recent studies have investigated the effects of different substituents on the biological activity of thiochromane derivatives, which makes 2-phenylthiochromane a valuable compound for ongoing research in medicinal chemistry.
- Fluorescent Properties: Some thiochromane derivatives exhibit interesting fluorescent properties, which can be beneficial in the development of optical sensors or probes in biological systems.
In conclusion, the combination of unique structural features and potential applications makes 2-phenylthiochromane an exciting compound in the field of chemistry. Its study not only enhances our understanding of thiochromane derivatives but also paves the way for future discoveries in pharmaceuticals and material science.
Synonyms
THIOFLAVIN
2-phenyl-3,4-dihydro-2H-thiochromene
5961-99-9
DTXSID20894766
DTXCID901324329
thioflavan
2-PHENYLTHIOCHROMAN
SCHEMBL44650
NRYGFMAOIPXXBW-UHFFFAOYSA-
NRYGFMAOIPXXBW-UHFFFAOYSA-N
DB-314314
InChI=1/C15H14S/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h1-9,15H,10-11H2
Solubility of 2-phenylthiochromane
2-phenylthiochromane, a fascinating chemical compound, exhibits interesting solubility characteristics that are influenced by its molecular structure. Here are some key points regarding its solubility:
Overall, the solubility of 2-phenylthiochromane reflects typical behaviors of organic compounds, where the structure of the molecule directly influences its ability to dissolve in various solvents. Therefore, understanding these solubility traits is crucial for its applications in chemical processes.