Interesting facts
Exploring 2,4-Dimethylbenzofuran
2,4-Dimethylbenzofuran is an intriguing compound that falls within the realm of benzofurans, where a fused benzene and furan ring structure contributes to its unique chemical properties. Here are some fascinating facts about this compound:
- Structural Significance: The presence of two methyl groups at the 2 and 4 positions of the benzene ring means that this compound likely exhibits interesting electronic properties. These substitutions can influence the reactivity and stability of the molecule.
- Biological Activity: Compounds like 2,4-dimethylbenzofuran are under investigation for their potential biological activities. Research indicates that benzofurans can possess anti-inflammatory, antimicrobial, and even anticancer properties, though specific studies on this derivative are ongoing.
- Applications in Chemistry: The versatile nature of benzofurans makes them valuable in the field of organic synthesis. 2,4-Dimethylbenzofuran may serve as a building block for synthesizing more complex organic molecules, facilitating advancements in medicinal chemistry.
- Flavor and Fragrance Profile: Interestingly, some benzofuran derivatives are known for contributing to unique flavor and aroma profiles. The inclusion of 2,4-dimethylbenzofuran may enhance the scent of certain perfumery compositions.
Overall, the study of 2,4-dimethylbenzofuran opens new avenues for research and application in both medicinal and synthetic chemistry. As researchers continue to probe its properties and possibilities, this compound stands as a testament to the richness of chemical discovery!
Synonyms
2,4-dimethyl-1-benzofuran
SCHEMBL433952
SCHEMBL7962545
AKOS006373245
InChI=1/C10H10O/c1-7-4-3-5-10-9(7)6-8(2)11-10/h3-6H,1-2H
Solubility of 2,4-Dimethylbenzofuran
2,4-Dimethylbenzofuran, with its unique structure, demonstrates intriguing solubility properties that stem from both its molecular composition and the functional groups present.
Generally, the solubility of this compound can be characterized as follows:
In summary, while 2,4-dimethylbenzofuran shows low solubility in polar environments, its compatibility with various non-polar solvents offers avenues for its practical use in different chemical applications. Understanding these solubility traits is crucial for chemists working with this compound.