Interesting facts
Interesting Facts About 2,4,6-Triisopropyl-1,3,5-triazine
2,4,6-Triisopropyl-1,3,5-triazine is a fascinating compound that showcases the diversity of nitrogen-containing heterocycles. This compound belongs to the triazine family, which is known for its unique structural characteristics and versatility in various applications. Here are some intriguing facts about this compound:
- Structural Complexity: The presence of three isopropyl substituents on the triazine ring not only enhances its steric properties but also contributes to its chemical reactivity. Such bulky groups can influence the compound’s interactions with other molecules.
- Agrochemical Potential: Compounds related to triazines are widely recognized for their use in agricultural chemicals, especially as herbicides. The reactivity and stability of triazines make them suitable candidates for developing effective agrochemicals.
- Synthesis Importance: The synthesis of 2,4,6-triisopropyl-1,3,5-triazine is of particular interest in the field of organic chemistry. Researchers often explore innovative synthetic pathways to create such compounds. A common method involves utilizing nucleophilic substitution reactions in the presence of appropriate catalysts.
- Exploration in Materials Science: Due to its unique chemical properties, this triazine derivative may find applications in materials science, potentially leading to new polymers or composite materials with desirable traits like durability and resistance to degradation.
- Research Buzz: The study of triazine compounds continues to expand within the scientific community, drawing the attention of chemists interested in exploring not only their pharmaceutical potential but also their functions as ligands in coordination chemistry.
In summary, 2,4,6-triisopropyl-1,3,5-triazine is more than just a trivial compound; it represents a rich field of study that bridges organic synthesis, agricultural science, and materials research. Its distinct structure and potential applications invite further exploration and intrigue among chemists.
Synonyms
SCHEMBL11802553
InChI=1/C12H21N3/c1-7(2)10-13-11(8(3)4)15-12(14-10)9(5)6/h7-9H,1-6H
Solubility of 2,4,6-triisopropyl-1,3,5-triazine
Understanding the solubility of 2,4,6-triisopropyl-1,3,5-triazine is crucial for its application in various chemical processes. This compound, characterized by its unique molecular structure, exhibits specific solubility behaviors:
In summary, the solubility of 2,4,6-triisopropyl-1,3,5-triazine is influenced by factors such as the type of solvent, temperature, and concentration. Recognizing these parameters is essential for optimizing its use in various chemical applications.