Interesting facts
Interesting Facts about 3-Methylnonane
3-Methylnonane is a fascinating hydrocarbon that belongs to the class of alkanes, specifically the nonane family. It is an isomer of nonane, meaning it shares the same molecular formula but differs in the arrangement of its atoms, making it a part of the saturated hydrocarbons.
Key Characteristics
- Structural Diversity: 3-Methylnonane features a branched structure, with a methyl group attached to the third carbon of the nonane chain. This structural variation contributes to its unique physical and chemical properties.
- Applications: This compound is primarily used as a high-quality solvent and as a component in some fuels, contributing to the performance of gasoline and other energy sources.
- Environmental Impact: Like many hydrocarbons, its presence and behavior in the environment raise concerns regarding emissions and pollution, especially when derived from petrochemical processes.
Fun Facts
- 3-Methylnonane is often studied in the field of organic chemistry for its interesting reactivity and potential interactions with other organic substances.
- As part of fuel formulations, it can significantly influence the fuel properties such as octane ratings.
- It gains significance in research related to combustion, especially in understanding the mechanisms of energy production in engines.
In summary, 3-methylnonane is more than just a simple hydrocarbon; it is a compound that plays various roles in chemistry and industry. As a student or scientist, studying such compounds can unveil the complexities and interdependencies in organic chemistry. The statement "Every molecule tells a story," perfectly encapsulates the tale of 3-methylnonane and its many applications!
Synonyms
3-METHYLNONANE
Nonane, 3-methyl-
DTXSID70863649
EINECS 227-631-6
Nonane, 3methyl
DTXCID70812238
227-631-6
5911-04-6
3-methyl nonane
3-mrthylnonane
3-methyl-nonane
MFCD00027308
3-Methylnonane, (DL)-
LMFA11000617
3-Methylnonane, >=99.0% (GC)
AKOS024319124
DB-053320
CS-0453989
M0282
NS00047405
T72672
Q2815998
InChI=1/C10H22/c1-4-6-7-8-9-10(3)5-2/h10H,4-9H2,1-3H
Solubility of 3-methylnonane
3-methylnonane, with its molecular structure comprising a branched aliphatic hydrocarbon, exhibits limited solubility in polar solvents. As a member of the alkane family, its solubility properties can be summarized as follows:
In practical applications, it is essential to consider these solubility characteristics when working with 3-methylnonane, especially in terms of environmental impact and extraction processes. As a hydrocarbon, it showcases the tendency of organic compounds to segregate from aqueous media, reinforcing the principle that "like dissolves like." Thus, if you are investigating its behavior in different solvent systems, expect minimal interaction with polar solvents.