Interesting facts
Interesting Facts about 3,4-Dichloro-2-methoxy-2H-furan-5-one
3,4-Dichloro-2-methoxy-2H-furan-5-one is a fascinating compound with a unique structure and significant implications in various scientific fields. Here are some notable points about this intriguing molecule:
- **Structure and Characteristics:** This compound is characterized by the presence of a furan ring, a five-membered lactone that exhibits interesting electronic properties due to its aromatic nature. The dichlorine substituents add to the complexity of this compound, potentially altering its reactivity and solubility.
- **Synthetic Applications:** The unique structure makes 3,4-dichloro-2-methoxy-2H-furan-5-one a valuable intermediate in organic synthesis. It can be utilized for the synthesis of various pharmaceuticals and agrochemicals, contributing to advancements in medicinal chemistry.
- **Biological Activity:** Compounds featuring the furan structure have been shown to exhibit a range of biological activities, including antimicrobial and anti-inflammatory properties. This positions 3,4-dichloro-2-methoxy-2H-furan-5-one as a candidate for further biological studies.
- **Environmental Impact:** The chlorinated nature of this compound raises questions regarding its stability and persistence in the environment, making it a significant topic of study in environmental chemistry.
- **Intriguing Reactions:** The presence of multiple functional groups opens the door to various chemical reactions, including electrophilic substitution and nucleophilic addition. This versatility is a point of interest for chemists looking to explore new pathways in organic synthesis.
In summary, 3,4-dichloro-2-methoxy-2H-furan-5-one is much more than just a complex name—it embodies the intersection of chemistry, biology, and environmental science. As scientists continue to unravel its potential, the compound is sure to remain at the forefront of research and application.
Synonyms
3,4-Dichloro-5-methoxy-2(5H)-furanone
2(5H)-FURANONE, 3,4-DICHLORO-5-METHOXY-
23066-93-5
3,4-dichloro-5-methoxyfuran-2(5h)-one
BRN 0127365
CHEMBL4238251
SCHEMBL14505730
QSPUPLRXWNBTDL-UHFFFAOYSA-
DTXSID80945743
QSPUPLRXWNBTDL-UHFFFAOYSA-N
5-18-01-00049 (Beilstein Handbook Reference)
InChI=1/C5H4Cl2O3/c1-9-5-3(7)2(6)4(8)10-5/h5H,1H3
Solubility of 3,4-Dichloro-2-methoxy-2H-furan-5-one
The solubility of 3,4-dichloro-2-methoxy-2H-furan-5-one can be assessed by considering various factors such as its molecular structure, polarity, and the presence of functional groups. This compound possesses both polar and non-polar characteristics, influencing its interaction with solvents.
In general, the solubility of a compound can be evaluated through:
Some noteworthy points about the solubility of this compound include:
In conclusion, 3,4-dichloro-2-methoxy-2H-furan-5-one exhibits interesting solubility properties that depend on its environment and conditions. Understanding these can aid in its application in various chemical processes.