Interesting facts
Interesting Facts about 4-butoxy-N,N-bis(2-chloroethyl)aniline
4-butoxy-N,N-bis(2-chloroethyl)aniline is an intriguing compound that showcases the fascinating intersection of organic chemistry and medicinal applications. Here are some noteworthy points:
- Functional Groups: This compound contains an aniline structure, which is significant in the development of dyes and pharmaceuticals. The addition of the butoxy and chloroethyl groups enhances its chemical reactivity and potential applications.
- Applications in Medicine: Compounds with similar structures have been explored for their potential in treating various ailments due to their ability to interact with biological systems. They may function as intermediates in the synthesis of more complex pharmaceuticals.
- Environmental Considerations: The presence of chlorine atoms often implies a need for careful handling due to potential environmental impact. Compounds with chlorinated groups can exhibit persistence in the environment, prompting discussions about biodegradability and safety.
- Important Intermediates: The synthesis of 4-butoxy-N,N-bis(2-chloroethyl)aniline serves as an excellent example of how organic compounds can act as intermediates, facilitating the production of various industrial chemicals and materials.
- Structure-Activity Relationship (SAR): This compound is a prime candidate for SAR studies, where researchers can explore how variations in structure impact biological activity. Such research is essential for the development of new therapeutic agents.
As a chemistry student or scientist, exploring compounds like 4-butoxy-N,N-bis(2-chloroethyl)aniline not only deepens your understanding of organic reactions but also keeps you connected to the evolving field of medicinal chemistry. Its versatility paves the way for exciting future research opportunities!
Synonyms
N,N-Bis(2-chloroethyl)-p-butoxyaniline
27077-15-2
ANILINE, N,N-BIS(2-CHLOROETHYL)-p-BUTOXY-
BRN 2978865
Aniline, p-butoxy-N,N-bis(2-chloroethyl)-
Benzenamine, 4-butoxy-N,N-bis(2-chloroethyl)-
p-N,N-Bis(2-chloroethyl)aminophenol butyl ether
DTXSID00181540
RefChem:319628
DTXCID40104031
Aniline, p-butoxy-N,N-bis(2-chloroethyl)-(8CI)
Benzenamine, 4-butoxy-N,N-bis(2-chloroethyl)-(9CI)
NSC 43814
A 20445
CHEMBL3246968
SCHEMBL12421704
NSC43814
NSC-43814
Solubility of 4-butoxy-N,N-bis(2-chloroethyl)aniline
The solubility of 4-butoxy-N,N-bis(2-chloroethyl)aniline in various solvents is an important aspect to consider for its practical applications. This compound tends to exhibit the following solubility characteristics:
When discussing solubility, it's important to note that "like dissolves like" applies here – the polar and non-polar characteristics of the solvent and solute play a **critical role** in solubility behavior. Therefore, selecting the appropriate solvent is essential when working with 4-butoxy-N,N-bis(2-chloroethyl)aniline.
Understanding these solubility properties can enhance the effective use of this compound in chemical processes and research.