Interesting facts
Interesting Facts about 4-Chloro-2-ethyl-phenol
4-Chloro-2-ethyl-phenol, also known as 4-chloro-2-ethyl-1-hydroxybenzene, is a compound that belongs to the family of chlorophenols, which are notable for their diverse applications and intriguing properties. Here are some fascinating insights:
- Antimicrobial Properties: This compound exhibits significant antimicrobial activity, making it useful in the formulation of disinfectants and preservatives. Its effectiveness against various bacteria and fungi has made it valuable in both medical and industrial settings.
- Uses in Industry: 4-Chloro-2-ethyl-phenol is often utilized in the synthesis of various agrochemicals, especially pesticides. This has made it an important compound in agricultural science for protecting crops from pests.
- Flavor Enhancer: Interestingly, this compound can contribute to flavor profiles in certain food products. It has been noted for its potential role in enhancing the taste of various substances.
- Research Interest: Due to its unique structure, many researchers are investigating the reactivity and potential transformation pathways of chlorophenols in environmental contexts. Understanding these properties can help in assessing the ecological impact of chlorophenol contaminants.
- Regulatory Perspectives: Given its chemical nature and potential health effects, 4-chloro-2-ethyl-phenol is subject to various regulatory guidelines. Knowing the safe handling and environmental impact is crucial for its use.
In summary, 4-chloro-2-ethyl-phenol is not only a compound of commercial interest but also an exciting area of exploration for scientists. Its multifaceted applications underscore the importance of studying chemical compounds in depth.
Synonyms
4-Chloro-2-ethylphenol
18979-90-3
108-802-3
InChI=1/C8H9ClO/c1-2-6-5-7(9)3-4-8(6)10/h3-5,10H,2H2,1H
Phenol, 4-chloro-2-ethyl-
EINECS 242-717-3
4-CHLORO-2-ETHYL-PHENOL
SCHEMBL364080
SCHEMBL4068420
SCHEMBL27810761
DTXSID50172408
QCEDDUSMBLCRNH-UHFFFAOYSA-N
MFCD00128091
MB00701
NS00026204
Solubility of 4-chloro-2-ethyl-phenol
The solubility of 4-chloro-2-ethyl-phenol can be characterized by several key factors:
As stated in scientific literature, "the solubility of a compound is affected by its functional groups, molecular size, and overall polarity." Thus, understanding the unique properties of 4-chloro-2-ethyl-phenol helps predict its behavior in various chemical environments.