Interesting facts
Interesting Facts About 5-(Diethylamino)-2-nitroso-phenol
5-(Diethylamino)-2-nitroso-phenol is a fascinating compound renowned for its unique chemical structure and significant applications. Here are some intriguing points to consider:
- Dual Functionality: This compound plays a role in both organic synthesis and analytical chemistry. Its nitroso group has the potential to engage in various chemical reactions, making it a versatile building block for more complex molecules.
- Indicator Properties: The presence of the nitroso group in its structure often allows 5-(diethylamino)-2-nitroso-phenol to act as a chromogenic indicator. It can change color in response to pH changes, which is useful in titrations and other analytical methods.
- Biological Relevance: Some derivatives of phenolic compounds are known for possessing antioxidant properties. Research into 5-(diethylamino)-2-nitroso-phenol may lend insight into its potential biological applications, especially in pharmaceuticals.
- Research Opportunities: Given its intriguing properties, this compound may be a subject of ongoing research into its reactivity and stability under various conditions. Exploring its behavior can lead to the discovery of new chemical pathways.
- Synthesis Challenges: The process of synthesizing this compound can sometimes be challenging. Chemists need to employ specific conditions to ensure optimal yield and purity, showcasing the importance of precise methods in organic chemistry.
In summary, 5-(diethylamino)-2-nitroso-phenol is not just another compound; its unique properties and potential applications make it a subject of curiosity and research in the fields of chemistry and materials science. As with many chemical compounds, its study may lead to new discoveries that further our understanding of its capabilities and applications.
Synonyms
5-(Diethylamino)-2-nitrosophenol
6358-20-9
633-188-3
NSC677529
SCHEMBL374911
2-nitroso-5-diethylaminophenol
DTXSID9043859
NXYYRSJPSPRDEO-UHFFFAOYSA-N
5-(diethylamino)-2-nitroso-phenol
AKOS006229672
NSC-677529
H26936
InChI=1/C10H14N2O2/c1-3-12(4-2)8-5-6-9(11-14)10(13)7-8/h5-7,13H,3-4H2,1-2H
Solubility of 5-(diethylamino)-2-nitroso-phenol
The solubility of 5-(diethylamino)-2-nitroso-phenol can be quite intriguing due to its chemical structure and functional groups. The presence of the diethylamino group suggests that this compound may exhibit notable solubility characteristics, as amine groups often form hydrogen bonds with solvents, enhancing solubility.
Several factors influence its solubility:
For practical purposes, it is commonly observed that compounds with similar structures exhibit solubility in organic solvents while showing limited solubility in water. Remember that the specific solubility of 5-(diethylamino)-2-nitroso-phenol can vary based on concentration, pH, and the presence of other solutes. As always, empirical testing remains essential for definitive solubility data.