Interesting facts
              Interesting Facts About 6-Oxopyran-2,4-dicarboxylic Acid
6-Oxopyran-2,4-dicarboxylic acid is a fascinating compound that has garnered the attention of chemists due to its intriguing structural characteristics and potential applications. Here are some compelling aspects of this compound:
- Cyclic Structure: The compound features a unique pyran ring, which adds to its chemical reactivity and stability. This cycle is essential in various biological and synthetic pathways.
 - Dicarboxylic Acids: Being a dicarboxylic acid, it possesses two carboxylic acid functional groups that enhance its acidity and reactivity, making it an interesting candidate for creating esters and anhydrides.
 - Biological Relevance: Compounds containing similar structures have been studied for their potential roles in drug synthesis and development, showcasing the relevance of 6-oxopyran-2,4-dicarboxylic acid in medicinal chemistry.
 - Versatile Reactions: This compound can participate in various reactions, including oxidation and esterification, making it a versatile building block in organic synthesis.
 - Research Opportunities: As scientists continue to explore the properties and potential applications of this compound, it stands as a promising subject for research in fields such as material science and pharmaceuticals.
 
As with many chemical compounds, understanding the properties of 6-oxopyran-2,4-dicarboxylic acid not only deepens our knowledge of organic chemistry but also opens up avenues for new innovations.
Synonyms
          2-oxo-2H-pyran-4,6-dicarboxylic acid
          72698-24-9
          6-oxopyran-2,4-dicarboxylic acid
          2-pyrone-4,6-dicarboxylic acid
          2H-Pyran-4,6-dicarboxylic acid, 2-oxo-
          alpha-pyrone-4,6-dicarboxylic acid
          C03671
          pyrone-4,6-dicarboxylic acid
          SCHEMBL1843937
          CHEBI:17872
          DTXSID50222997
          2-oxo-2H-pyran-4,6-dicarboxylicacid
          6-Oxo-6H-pyran-2,4-dicarboxylic acid
          H20154
          Q27102682
          0GZ
          InChI=1/C7H4O6/c8-5-2-3(6(9)10)1-4(13-5)7(11)12/h1-2H,(H,9,10)(H,11,12
              
Solubility of 6-oxopyran-2,4-dicarboxylic acid
The solubility of 6-oxopyran-2,4-dicarboxylic acid (C7H4NO5) is influenced by its chemical structure and functional groups. Here are some key points regarding its solubility:
In summary, 6-oxopyran-2,4-dicarboxylic acid exhibits reasonable solubility in polar environments due to its structural characteristics, making it versatile for various chemical applications.