Interesting facts
              Interesting Facts about 6,7-Dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium
6,7-Dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium is a fascinating compound that showcases the rich diversity of organic chemistry. Here are some intriguing points about this compound:
- Structural Complexity: This compound belongs to the isoquinoline family, which is characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. Its unique structure makes it a compelling subject for studies in both medicinal and synthetic chemistry.
- Biological Relevance: Compounds that contain the isoquinoline moiety are known for their wide range of biological activities. This includes effects on the central nervous system and potential applications in treating diseases such as Parkinson's and Alzheimer's.
- Psychoactive Properties: Some derivatives of isoquinolines are studied for their psychoactive properties, leading to exploration in fields such as pharmacology and neurochemistry.
- Potential as a Therapeutic Agent: Research has suggested that compounds like 6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium could serve as starting materials for the development of new therapeutic agents, particularly in combating neurodegenerative diseases.
- Innovative Synthesis: The synthesis of this compound typically involves intricate multi-step organic reactions, making it an excellent example for students and researchers to study various synthetic techniques.
According to a recent study, "the intricate chemistry surrounding isoquinolines provides a pivotal understanding of their potential effects on human health," highlighting the importance of exploring such compounds.
Overall, 6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium illustrates the rich interplay between structure and function in organic compounds, serving as a reminder of the endless opportunities that chemistry has to offer.
Synonyms
          6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolinium
          32749-01-2
          3,4-Dihydro-6,7-dimethoxy-2-methylisoquinolinium
          isoquinolinium, 3,4-dihydro-6,7-dimethoxy-2-methyl-
          CHEMBL37607
          6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium
          SCHEMBL3699579
          CHEMBL1178693
          DTXSID201238608
          BBL036796
          BDBM50014649
          STL553534
          AKOS037503421
          RTE3_000037
          NCGC00246212-01
          PK04_181312
          6,7-Dimethoxy-2-methyl-3,4-dihydro-isoquinolinium; iodide
          InChI=1/C12H16NO2/c1-13-5-4-9-6-11(14-2)12(15-3)7-10(9)8-13/h6-8H,4-5H2,1-3H3/q+
              
Solubility of 6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium
The solubility of 6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium in various solvents can provide significant insights into its potential applications and reactivity. Understanding its solubility characteristics involves several key factors:
In general, ionized compounds like this isoquinolinium variant tend to exhibit higher solubility in aqueous solutions due to their ability to interact favorably with water molecules. However, solubility can also depend on:
Due to its complex structure, literature should be consulted for specific solubility data. It is essential to note that solubility is not a fixed property and can vary significantly based on external conditions, emphasizing the importance of rigorous testing and characterization.