Interesting facts
Interesting Facts About Cyclopentylcyclopentane
Cyclopentylcyclopentane is a fascinating compound within the realm of organic chemistry, notable for its unique structure and potential applications. Here are some intriguing aspects of this compound:
- Structure and Configuration: This compound consists of two cyclopentane rings that are fused together. The distinctive bond between the rings helps to give it a unique three-dimensional conformation, making it an interesting subject of study in stereochemistry.
- Applications in Research: Due to its unique structural properties, cyclopentylcyclopentane is often explored in research focused on materials science and chemical synthesis. Its potential as a building block in organic synthesis may provide avenues for discovering new compounds with desirable properties.
- Relation to Aromatic Compounds: While not aromatic itself, cyclopentylcyclopentane can be compared to aromatic compounds in terms of stability and reactivity. Understanding its behavior can offer insight into the stability characteristics of more complex organic structures.
- Cycloalkanes and Isomerism: The compound is part of cycloalkanes which are saturated hydrocarbons characterized by rings. Its study sheds light on isomerism and the effects of ring strain in various cyclic structures.
- Physical Properties: Cyclopentylcyclopentane’s properties, such as its reactivity under various conditions, are of great interest. Its relatively simple structure allows chemists to predict its behavior in reactions, making it a useful molecule for teaching and research.
- Potential as a Solvent: There is ongoing research into the solvent capabilities of cyclopentylcyclopentane, particularly in nonpolar solvents. Its distinct structure may influence the solvation of various solutes.
In summary, cyclopentylcyclopentane is more than just a simple compound; it represents a myriad of research opportunities in organic chemistry and materials science. As one scientist noted, "Understanding the nuances of such compounds is key to innovating in chemical applications."
Whether exploring its unique structure, potential applications, or its role in broader studies, cyclopentylcyclopentane continues to pique the interest of chemists and researchers alike.
Synonyms
Bicyclopentyl
1636-39-1
Cyclopentylcyclopentane
1,1'-BICYCLOPENTYL
Bicyclopentane
Dicyclopentyl
Cyclopentane, cyclopentyl-
NSC-38865
1,?1'-?Bicyclopentyl
NSC38865
EINECS 216-666-2
1,1'-BI(CYCLOPENTANE)
MAWOHFOSAIXURX-UHFFFAOYSA-
DTXSID80167625
C75YPF7243
NSC 38865
AKOS006271494
DB-318748
NS00049083
InChI=1/C10H18/c1-2-6-9(5-1)10-7-3-4-8-10/h9-10H,1-8H2
Solubility of Cyclopentylcyclopentane
Cyclopentylcyclopentane, with the chemical formula C10H16, exhibits unique solubility characteristics due to its cyclic structure and hydrocarbon nature.
Here’s a breakdown of its solubility aspects:
In summary, the solubility behavior of cyclopentylcyclopentane is dominated by its non-polar nature, allowing it to dissolve well in non-polar solvents while remaining largely insoluble in polar ones. As it is often said in chemistry, "like dissolves like."