Interesting facts
Interesting Facts About Dichloro(ethyl)silane
Dichloro(ethyl)silane is a fascinating organosilicon compound that offers a unique perspective into the world of silicon chemistry. Here are some compelling aspects of this compound:
- Versatile Building Block: Dichloro(ethyl)silane serves as an important intermediate in the synthesis of various silicon-containing materials, including siloxanes and silanes, which are used extensively in the chemical industry.
- Surface Modification: This compound is commonly used in surface modification applications, enhancing the properties of materials such as glass, metals, and polymers. It aids in improving adhesion and hydrophobic characteristics.
- Electronics Applications: Thanks to its reactivity, dichloro(ethyl)silane is employed in the manufacturing of thin films and coatings that are pivotal in the electronics sector, especially in semiconductors.
- Research Significance: In chemical research, dichloro(ethyl)silane is utilized to create functionalized silica materials, broadening the horizons for potential applications in catalysis and nanostructured materials.
- Environmental Impact: As with many chlorinated compounds, it's pertinent to handle dichloro(ethyl)silane with care due to its potential environmental effects and toxicity, underscoring the importance of safety protocols in chemical handling.
In conclusion, dichloro(ethyl)silane embodies a myriad of applications and significance in the realm of chemistry. Its versatility gives it a vital role in both industrial and research settings, making it an intriguing subject for further exploration and study.
Synonyms
Dichloro-ethylsilane
dichloro(ethyl)silane
dichloro-ethyl-silane
RKHXNBJRDQOIOQ-UHFFFAOYSA-
Dichloroethylsilane, >=98.0% (AT)
NS00048504
Q27280292
InChI=1/C2H6Cl2Si/c1-2-5(3)4/h5H,2H2,1H3
Solubility of Dichloro(ethyl)silane
Dichloro(ethyl)silane, with the chemical formula C2H6Cl2Si, exhibits specific solubility characteristics that are noteworthy. This compound is generally considered to be:
In terms of its solubility behavior, it is important to note that:
In summary, understanding the solubility of dichloro(ethyl)silane is essential for its practical applications, particularly in organic synthesis and chemical reactions, where the choice of solvent can greatly influence the outcome.