Interesting facts
Interesting Facts about Imidazo[1,2-a]quinoxaline
Imidazo[1,2-a]quinoxaline is an intriguing heterocyclic compound that has garnered attention in the field of medicinal chemistry and organic synthesis. Here are some fascinating insights into this compound:
- Structure and Chemistry: Imidazo[1,2-a]quinoxaline is characterized by a bicyclic framework, which includes an imidazole and quinoxaline moiety. This unique structure imparts distinctive chemical properties and reactivity patterns.
- Biological Activity: A notable aspect of imidazo[1,2-a]quinoxaline is its potential biological activity. Research has indicated that derivatives of this compound exhibit various pharmacological effects, such as:
- Antimicrobial properties
- Anticancer effects
- Neuroprotective capabilities
- Applications: Its intriguing properties have led to a range of applications in:
- Drug discovery
- Development of fluorescent probes
- Material science
- Synthetic Routes: The synthesis of imidazo[1,2-a]quinoxaline can be approached through several methodologies, including:
- Condensation reactions
- Cyclization processes
- Multicomponent reactions
- Research Significance: Ongoing studies continue to explore its potential:
"Compounds like imidazo[1,2-a]quinoxaline are essential in the quest for next-generation pharmaceuticals." - A leading researcher in medicinal chemistry.
As a compound bridging organic synthesis and pharmacology, imidazo[1,2-a]quinoxaline exemplifies the importance of heterocycles in modern science, making it a subject of interest for many researchers.
Synonyms
imidazo[1,2-a]quinoxaline
235-05-2
IMIDAZO(1,2-a)QUINOXALINE
BRN 0608447
SCHEMBL1417158
VTNBGTYLJIUATL-UHFFFAOYSA-
DTXSID70178063
AKOS006277660
InChI=1/C10H7N3/c1-2-4-9-8(3-1)12-7-10-11-5-6-13(9)10/h1-7H
Solubility of Imidazo[1,2-a]quinoxaline
Imidazo[1,2-a]quinoxaline, a fused heterocyclic compound, presents intriguing characteristics when it comes to its solubility properties. Understanding the solubility of this compound is essential, as it plays a crucial role in various chemical and biological applications.
In general, the solubility of imidazo[1,2-a]quinoxaline can be summarized as follows:
As stated, “Like dissolves like,” and thus, the molecular structure implies that it prefers to dissolve in similar polar environments rather than in aqueous medium. This solubility behavior is fundamental in applications such as drug formulation, where solubility influences bioavailability.
In conclusion, while imidazo[1,2-a]quinoxaline shows promising solubility in certain solvents, challenges in water solubility highlight the importance of considering solvent choice in its practical usage.