Interesting facts
Interesting Facts about N-(3-morpholin-4-ium-4-ylpropyl)-2,2-diphenoxy-acetamide;chloride
N-(3-morpholin-4-ium-4-ylpropyl)-2,2-diphenoxy-acetamide;chloride is a compound that showcases the fascinating interplay of organic chemistry and medicinal applications. Here are some noteworthy aspects:
- Structural Complexity: This compound features a unique structure that incorporates both a morpholine ring and phenoxy groups. The presence of these functional groups allows for a range of interactions, making it a subject of interest in drug design.
- Biological Relevance: Many compounds with morpholine moieties are known for their biological activities. They are often investigated for their potential as pharmaceuticals, particularly in treating neurological disorders and infections.
- Versatile Applications: The diphenoxy and acetamide components may enhance solubility and interaction with biological targets, facilitating their use in various biomedical applications.
- Charge Considerations: The presence of a chloride ion provides insight into the compound's ionic nature, which can influence its solubility and interaction with biological systems.
- Research Interests: Scientists are particularly curious about compounds with dual functionalities, as they can serve multiple purposes in a single molecular entity, paving the way for innovative therapeutic strategies.
- Potential for Drug Development: Given its complex and selective structural characteristics, this compound could be further explored for its potential as a lead compound in drug discovery, particularly in the fields of oncology and neurology.
In summary, N-(3-morpholin-4-ium-4-ylpropyl)-2,2-diphenoxy-acetamide;chloride represents a rich area of research potential, blending organic synthesis with pharmacological relevance. Its unique structural attributes and charge characteristics make it a compelling subject for further study in the scientific community.
Synonyms
2,2-Diphenoxy-N-(morpholinopropyl)acetamide hydrochloride
LL 195
N-(3-Morpholinopropyl)diphenoxacetamide hydrochloride
5220-93-9
NSC 169871
Acetamide, 2,2-diphenoxy-N-(morpholinopropyl)-, hydrochloride
Chlorhydrate de N(N' propylmorpholinyl) diphenoxyacetamide [French]
Glyoxylamide, N-(3-morpholinopropyl)-, 2-(diphenyl acetal), monohydrochloride
Chlorhydrate de N(N' propylmorpholinyl) diphenoxyacetamide
Acetamide, N-(3-(4-morpholinyl)propyl)-2,2-diphenoxy-, monohydrochloride
GLYOXYLAMIDE, N-(3-MORPHOLINOPROPYL)-, 2-(DIPHENYLACETAL), MONOHYDROCHLORIDE
Solubility Overview of N-(3-morpholin-4-ium-4-ylpropyl)-2,2-diphenoxy-acetamide;chloride
The solubility of N-(3-morpholin-4-ium-4-ylpropyl)-2,2-diphenoxy-acetamide;chloride, often abbreviated as a complex quaternary ammonium compound, can be influenced by several factors. Understanding these can provide insights into its practical applications in various fields, such as pharmaceuticals and materials science. This compound's solubility characteristics are primarily determined by:
In conclusion, while specific solubility data may be limited, one can anticipate that N-(3-morpholin-4-ium-4-ylpropyl)-2,2-diphenoxy-acetamide;chloride is likely to exhibit notable solubility in polar solvents, with potential lesser solubility in nonpolar environments. This underscores the importance of solvent selection when working with this compound for practical applications.