Interesting facts
Interesting Facts about N-(4-chloro-2-nitro-phenyl)-N',N'-diethyl-ethane-1,2-diamine
N-(4-chloro-2-nitro-phenyl)-N',N'-diethyl-ethane-1,2-diamine is a fascinating compound, particularly noted in the field of medicinal chemistry and organic synthesis. Let's explore some of its intriguing aspects:
- Structural Characteristics: This compound features a distinct ethane backbone with diethyl groups attached to the nitrogen atoms, along with a complex aromatic ring that contains both a chloro and a nitro substituent, making it a versatile building block in various chemical reactions.
- Biological Relevance: The presence of the chloro and nitro groups in its structure often indicates potential applications in pharmaceuticals, such as in the development of antibacterial or anti-cancer agents, showcasing how small changes in molecular structure can result in significant differences in biological activity.
- Research Applications: This compound is of particular interest in the study of amine reactivity and can serve as an intermediate in the synthesis of more complex molecules. Researchers often explore its properties to understand better the dynamics of chemical reactions involving amines.
- Safety Considerations: Compounds like this one should be handled with care in the laboratory due to the presence of halogen and nitro groups, which can pose toxicity and environmental concerns. Understanding the safety profiles is crucial in both academic research and industrial applications.
- Educational Value: Chemistry students encounter compounds like N-(4-chloro-2-nitro-phenyl)-N',N'-diethyl-ethane-1,2-diamine when learning about functional groups and synthetic pathways, making it an essential subject of study in organic chemistry courses.
In conclusion, N-(4-chloro-2-nitro-phenyl)-N',N'-diethyl-ethane-1,2-diamine exemplifies the intricate relationships between molecular structure, reactivity, and biological activity. As scientists delve into the world of this compound, they uncover not just its properties, but the broader implications it has for medicinal chemistry and organic synthesis.
Synonyms
4-Chloro-N-(diethylaminoethyl)-2-nitroaniline
ANILINE, 4-CHLORO-N-(2-(DIETHYLAMINO)ETHYL)-2-NITRO-
24102-89-4
DTXSID60178830
RefChem:319618
DTXCID20101321
Oprea1_490774
CHEMBL1906964
STK023734
AKOS005209195
NCGC00245559-01
N'-(4-chloro-2-nitrophenyl)-N,N-diethylethane-1,2-diamine
Solubility of N-(4-chloro-2-nitro-phenyl)-N',N'-diethyl-ethane-1,2-diamine
The solubility of N-(4-chloro-2-nitro-phenyl)-N',N'-diethyl-ethane-1,2-diamine can be influenced by several factors, including its chemical structure, functional groups, and interactions with solvents.
Key points to consider about the solubility of this compound include:
In summary, solubility is a complex interplay of structural and environmental factors. As a general insight, compounds with both hydrophilic and hydrophobic components can exhibit unique solubility behaviors that are crucial for their applications in various fields. Understanding these characteristics, along with solubility parameters, can aid in predicting the behavior of N-(4-chloro-2-nitro-phenyl)-N',N'-diethyl-ethane-1,2-diamine in different chemical environments.